Compound Q&A

What industries use (trans-4-Propylcyclohexyl)benzene (CAS: 61203-94-9)?

Answer

(trans-4-Propylcyclohexyl)benzene
(trans-4-Propylcyclohexyl)benzene is utilized in various industries due to its unique chemical properties. It is employed in the synthesis of pharmaceuticals, where it acts as an intermediate. Additionally, it finds applications in the production of polymers, where it can enhance the mechanical properties of plastic materials. Its presence in sensor technologies and semiconductor manufacturing is also notable, contributing to the development of more efficient and reliable electronic devices.

About

CAS No 61203-94-9
English Name (trans-4-Propylcyclohexyl)benzene
Molecular Formula C15H22
Molecular Weight 202.34 g/mol
SMILES CCC[C@H]1CC[C@H](C2=CC=CC=C2)CC1
InChIKey PWGUTKLGUISGAE-CTYIDZIISA-N
Last Updated: 2026-03-29 08:05

Related Q&A

Compound Q&A

What are the physical and chemical properties of (trans-4-Propylcyclohexyl)benzene (CAS: 61203-94-9)?

(trans-4-Propylcyclohexyl)benzene is a colorless liquid with a molecular weight of approximately 154...

Compound Q&A

How is (trans-4-Propylcyclohexyl)benzene (CAS: 61203-94-9) typically synthesized?

(trans-4-Propylcyclohexyl)benzene is usually synthesized via a Friedel-Crafts alkylation reaction, w...

Compound Q&A

What precautions should be taken when handling (trans-4-Propylcyclohexyl)benzene (CAS: 61203-94-9)?

When handling (trans-4-Propylcyclohexyl)benzene, it is crucial to wear appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...