Compound Q&A

How is (trans-4-Propylcyclohexyl)benzene (CAS: 61203-94-9) typically synthesized?

Answer

(trans-4-Propylcyclohexyl)benzene
(trans-4-Propylcyclohexyl)benzene is usually synthesized via a Friedel-Crafts alkylation reaction, where toluene reacts with propionaldehyde in the presence of a Lewis acid catalyst like aluminum trichloride. The reaction conditions are mild, and high yields are achieved. This compound can also be prepared by the reduction of (trans-4-Propylcyclohexyl)benzoyl chloride, offering an alternative synthetic route.

About

CAS No 61203-94-9
English Name (trans-4-Propylcyclohexyl)benzene
Molecular Formula C15H22
Molecular Weight 202.34 g/mol
SMILES CCC[C@H]1CC[C@H](C2=CC=CC=C2)CC1
InChIKey PWGUTKLGUISGAE-CTYIDZIISA-N
Last Updated: 2026-03-29 08:05

Related Q&A

Compound Q&A

What are the physical and chemical properties of (trans-4-Propylcyclohexyl)benzene (CAS: 61203-94-9)?

(trans-4-Propylcyclohexyl)benzene is a colorless liquid with a molecular weight of approximately 154...

Compound Q&A

What industries use (trans-4-Propylcyclohexyl)benzene (CAS: 61203-94-9)?

(trans-4-Propylcyclohexyl)benzene is utilized in various industries due to its unique chemical prope...

Compound Q&A

What precautions should be taken when handling (trans-4-Propylcyclohexyl)benzene (CAS: 61203-94-9)?

When handling (trans-4-Propylcyclohexyl)benzene, it is crucial to wear appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...