Compound Q&A

What are the physical and chemical properties of (trans-4-Propylcyclohexyl)benzene (CAS: 61203-94-9)?

Answer

(trans-4-Propylcyclohexyl)benzene
(trans-4-Propylcyclohexyl)benzene is a colorless liquid with a molecular weight of approximately 154.26 g/mol. It has a low melting point of -24°C and a boiling point of 163°C. This compound is slightly soluble in water but soluble in common organic solvents. It is relatively stable under normal conditions but can react with strong acids and bases. It is not highly reactive but should be handled with care due to its potential to form explosive compounds with certain reagents.

About

CAS No 61203-94-9
English Name (trans-4-Propylcyclohexyl)benzene
Molecular Formula C15H22
Molecular Weight 202.34 g/mol
SMILES CCC[C@H]1CC[C@H](C2=CC=CC=C2)CC1
InChIKey PWGUTKLGUISGAE-CTYIDZIISA-N
Last Updated: 2026-03-29 08:05

Related Q&A

Compound Q&A

How is (trans-4-Propylcyclohexyl)benzene (CAS: 61203-94-9) typically synthesized?

(trans-4-Propylcyclohexyl)benzene is usually synthesized via a Friedel-Crafts alkylation reaction, w...

Compound Q&A

What industries use (trans-4-Propylcyclohexyl)benzene (CAS: 61203-94-9)?

(trans-4-Propylcyclohexyl)benzene is utilized in various industries due to its unique chemical prope...

Compound Q&A

What precautions should be taken when handling (trans-4-Propylcyclohexyl)benzene (CAS: 61203-94-9)?

When handling (trans-4-Propylcyclohexyl)benzene, it is crucial to wear appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...