Compound Q&A

What industries use 1,3-Dichloro-5-fluoro-2-nitrobenzene (CAS: 180134-21-8)?

Answer

1,3-Dichloro-5-fluoro-2-nitrobenzene
1,3-Dichloro-5-fluoro-2-nitrobenzene finds applications in the pharmaceutical industry for the synthesis of certain medicinal compounds. It is also used in the production of dyes and pigments, as well as in the development of sensors and materials for the semiconductor industry. Its unique chemical properties make it a valuable intermediate in various chemical processes.

About

English Name 1,3-Dichloro-5-fluoro-2-nitrobenzene
Molecular Formula C6H2Cl2FNO2
Molecular Weight 209.99 g/mol
SMILES C1=C(C=C(C(=C1Cl)[N+](=O)[O-])Cl)F
InChIKey JWOMHBXKHCIYHQ-UHFFFAOYSA-N
Last Updated: 2026-03-29 08:05

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,3-Dichloro-5-fluoro-2-nitrobenzene (CAS: 180134-21-8)?

1,3-Dichloro-5-fluoro-2-nitrobenzene is a dark yellow crystalline solid with a molecular weight of a...

Compound Q&A

How is 1,3-Dichloro-5-fluoro-2-nitrobenzene (CAS: 180134-21-8) typically synthesized?

1,3-Dichloro-5-fluoro-2-nitrobenzene can be synthesized via nitration and chlorination of 5-fluoro-2...

Compound Q&A

What precautions should be taken when handling 1,3-Dichloro-5-fluoro-2-nitrobenzene (CAS: 180134-21-8)?

When handling 1,3-Dichloro-5-fluoro-2-nitrobenzene, ensure the use of appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...