Compound Q&A

How is 1,3-Dichloro-5-fluoro-2-nitrobenzene (CAS: 180134-21-8) typically synthesized?

Answer

1,3-Dichloro-5-fluoro-2-nitrobenzene
1,3-Dichloro-5-fluoro-2-nitrobenzene can be synthesized via nitration and chlorination of 5-fluoro-2-nitrobenzene. The reaction involves the gradual addition of chlorine in the presence of a Lewis acid catalyst, followed by nitration using nitric acid in the presence of sulfuric acid. Reaction conditions and catalysts can influence the yield and selectivity of the product.

About

English Name 1,3-Dichloro-5-fluoro-2-nitrobenzene
Molecular Formula C6H2Cl2FNO2
Molecular Weight 209.99 g/mol
SMILES C1=C(C=C(C(=C1Cl)[N+](=O)[O-])Cl)F
InChIKey JWOMHBXKHCIYHQ-UHFFFAOYSA-N
Last Updated: 2026-03-29 08:05

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,3-Dichloro-5-fluoro-2-nitrobenzene (CAS: 180134-21-8)?

1,3-Dichloro-5-fluoro-2-nitrobenzene is a dark yellow crystalline solid with a molecular weight of a...

Compound Q&A

What industries use 1,3-Dichloro-5-fluoro-2-nitrobenzene (CAS: 180134-21-8)?

1,3-Dichloro-5-fluoro-2-nitrobenzene finds applications in the pharmaceutical industry for the synth...

Compound Q&A

What precautions should be taken when handling 1,3-Dichloro-5-fluoro-2-nitrobenzene (CAS: 180134-21-8)?

When handling 1,3-Dichloro-5-fluoro-2-nitrobenzene, ensure the use of appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...