Compound Q&A

What are the physical and chemical properties of 1,3-Dichloro-5-fluoro-2-nitrobenzene (CAS: 180134-21-8)?

Answer

1,3-Dichloro-5-fluoro-2-nitrobenzene
1,3-Dichloro-5-fluoro-2-nitrobenzene is a dark yellow crystalline solid with a molecular weight of approximately 262.03 g/mol. It has low solubility in water but is more soluble in organic solvents like ethanol and acetone. Chemically, it is highly reactive due to the presence of the nitro group and chlorine atoms, making it prone to substitution reactions and oxidation.

About

English Name 1,3-Dichloro-5-fluoro-2-nitrobenzene
Molecular Formula C6H2Cl2FNO2
Molecular Weight 209.99 g/mol
SMILES C1=C(C=C(C(=C1Cl)[N+](=O)[O-])Cl)F
InChIKey JWOMHBXKHCIYHQ-UHFFFAOYSA-N
Last Updated: 2026-03-29 08:05

Related Q&A

Compound Q&A

How is 1,3-Dichloro-5-fluoro-2-nitrobenzene (CAS: 180134-21-8) typically synthesized?

1,3-Dichloro-5-fluoro-2-nitrobenzene can be synthesized via nitration and chlorination of 5-fluoro-2...

Compound Q&A

What industries use 1,3-Dichloro-5-fluoro-2-nitrobenzene (CAS: 180134-21-8)?

1,3-Dichloro-5-fluoro-2-nitrobenzene finds applications in the pharmaceutical industry for the synth...

Compound Q&A

What precautions should be taken when handling 1,3-Dichloro-5-fluoro-2-nitrobenzene (CAS: 180134-21-8)?

When handling 1,3-Dichloro-5-fluoro-2-nitrobenzene, ensure the use of appropriate personal protectiv...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...