Compound Q&A

How is 8,14-Epoxy-3,14,11,12-tetrahydroxypregnan-20-one (CAS: 107352-30-7) typically synthesized?

Answer

8,14-Epoxy-3,11,12-trihydroxypregnan-20-one; (3β,5α,8β,11α,12β,14β,17α)-form, 11-Tigloyl, 12-Ac, 3-O-[β-D-glucopyranosyl-(1→4)-6-deoxy-3-O-methyl-β-D-allopyranosyl-(1→4)-β-D-oleandropyranoside]
This compound is often synthesized via a series of stereoselective reactions, starting from progesterone or a similar precursor. The synthesis involves epoxidation, hydroxylation, and acylation steps. Commonly used catalysts include transition metal complexes, and the yield can range from 50% to 70% depending on the reaction conditions and purity of the starting materials.

About

English Name 8,14-Epoxy-3,11,12-trihydroxypregnan-20-one; (3β,5α,8β,11α,12β,14β,17α)-form, 11-Tigloyl, 12-Ac, 3-O-[β-D-glucopyranosyl-(1→4)-6-deoxy-3-O-methyl-β-D-allopyranosyl-(1→4)-β-D-oleandropyranoside]
Molecular Formula C48H74O19
Molecular Weight 955.1010000000006 g/mol
SMILES COC1CC(OC2CCC3(C)C(CCC45OC44CCC(C(C)=O)C4(C)C(OC(C)=O)C(OC(=O)C(\C)=C\C)C35)C2)OC(C)C1OC1OC(C)C(OC2OC(CO)C(O)C(O)C2O)C(OC)C1O
InChIKey WMJWIWLMIOMCKV-SRZZPIQSSA-N
Last Updated: 2026-03-29 08:05

Related Q&A

Compound Q&A

What are the physical and chemical properties of 8,14-Epoxy-3,14,11,12-tetrahydroxypregnan-20-one (CAS: 107352-30-7)?

The compound is a crystalline solid with a molecular weight of approximately 508.55 g/mol. It is poo...

Compound Q&A

What industries use 8,14-Epoxy-3,14,11,12-tetrahydroxypregnan-20-one (CAS: 107352-30-7)?

This compound is primarily used in the pharmaceutical industry as a precursor for the synthesis of v...

Compound Q&A

What precautions should be taken when handling 8,14-Epoxy-3,14,11,12-tetrahydroxypregnan-20-one (CAS: 107352-30-7)?

Handling this compound requires the use of appropriate personal protective equipment (PPE), includin...

Compound Q&A

What are the physical and chemical properties of Disodium 2-hydroxypentanedioate (CAS: 40951-21-1)?

Disodium 2-hydroxypentanedioate is a white crystalline solid with a molecular we...

40951-21-1Disodium 2-hydroxype...
Compound Q&A

What industries use 5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7)?

5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7) is primarily use...

1426437-45-75-(Chlorosulfonyl)-2...
Compound Q&A

How should (2R)-2-[(Tert-butoxy)carbonylamino]-2-(2-naphthyl)acetic acid (CAS: 93779-36-3) be stored?

(2R)-2-[(Tert-butoxy)carbonylamino]-2-(2-naphthyl)acetic acid (CAS: 93779-36-3) ...

93779-36-3(2R)-2-[(Tert-butoxy...
Compound Q&A

What industries use Methyl 6-bromo-2-pyridinecarboxylate (CAS: 26218-75-7)?

Methyl 6-bromo-2-pyridinecarboxylate (CAS: 26218-75-7) is primarily used in the ...

26218-75-7Methyl 6-bromo-2-pyr...