Compound Q&A

What are the physical and chemical properties of 8,14-Epoxy-3,14,11,12-tetrahydroxypregnan-20-one (CAS: 107352-30-7)?

Answer

8,14-Epoxy-3,11,12-trihydroxypregnan-20-one; (3β,5α,8β,11α,12β,14β,17α)-form, 11-Tigloyl, 12-Ac, 3-O-[β-D-glucopyranosyl-(1→4)-6-deoxy-3-O-methyl-β-D-allopyranosyl-(1→4)-β-D-oleandropyranoside]
The compound is a crystalline solid with a molecular weight of approximately 508.55 g/mol. It is poorly soluble in water but is soluble in organic solvents such as ethanol and acetone. The compound is reactive towards nucleophiles and can undergo hydrolysis under basic conditions. This reactivity makes it useful in various synthetic applications.

About

English Name 8,14-Epoxy-3,11,12-trihydroxypregnan-20-one; (3β,5α,8β,11α,12β,14β,17α)-form, 11-Tigloyl, 12-Ac, 3-O-[β-D-glucopyranosyl-(1→4)-6-deoxy-3-O-methyl-β-D-allopyranosyl-(1→4)-β-D-oleandropyranoside]
Molecular Formula C48H74O19
Molecular Weight 955.1010000000006 g/mol
SMILES COC1CC(OC2CCC3(C)C(CCC45OC44CCC(C(C)=O)C4(C)C(OC(C)=O)C(OC(=O)C(\C)=C\C)C35)C2)OC(C)C1OC1OC(C)C(OC2OC(CO)C(O)C(O)C2O)C(OC)C1O
InChIKey WMJWIWLMIOMCKV-SRZZPIQSSA-N
Last Updated: 2026-03-29 08:05

Related Q&A

Compound Q&A

How is 8,14-Epoxy-3,14,11,12-tetrahydroxypregnan-20-one (CAS: 107352-30-7) typically synthesized?

This compound is often synthesized via a series of stereoselective reactions, starting from progeste...

Compound Q&A

What industries use 8,14-Epoxy-3,14,11,12-tetrahydroxypregnan-20-one (CAS: 107352-30-7)?

This compound is primarily used in the pharmaceutical industry as a precursor for the synthesis of v...

Compound Q&A

What precautions should be taken when handling 8,14-Epoxy-3,14,11,12-tetrahydroxypregnan-20-one (CAS: 107352-30-7)?

Handling this compound requires the use of appropriate personal protective equipment (PPE), includin...

Compound Q&A

What are the physical and chemical properties of Disodium 2-hydroxypentanedioate (CAS: 40951-21-1)?

Disodium 2-hydroxypentanedioate is a white crystalline solid with a molecular we...

40951-21-1Disodium 2-hydroxype...
Compound Q&A

What industries use 5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7)?

5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7) is primarily use...

1426437-45-75-(Chlorosulfonyl)-2...
Compound Q&A

How should (2R)-2-[(Tert-butoxy)carbonylamino]-2-(2-naphthyl)acetic acid (CAS: 93779-36-3) be stored?

(2R)-2-[(Tert-butoxy)carbonylamino]-2-(2-naphthyl)acetic acid (CAS: 93779-36-3) ...

93779-36-3(2R)-2-[(Tert-butoxy...
Compound Q&A

What industries use Methyl 6-bromo-2-pyridinecarboxylate (CAS: 26218-75-7)?

Methyl 6-bromo-2-pyridinecarboxylate (CAS: 26218-75-7) is primarily used in the ...

26218-75-7Methyl 6-bromo-2-pyr...