Compound Q&A

What industries use Ethyl 3-(3-pentanyloxy)benzoate (CAS: 1151665-78-9)?

Answer

Ethyl 3-(3-pentanyloxy)benzoate
Ethyl 3-(3-pentanyloxy)benzoate (CAS: 1151665-78-9) is used in various industries, particularly in the pharmaceutical and polymer sectors. It serves as a key intermediate in the synthesis of complex organic compounds and can be used as a monomer in polymer synthesis. Additionally, it has applications in sensor technology and as a functional additive in the production of semiconductors.

About

English Name Ethyl 3-(3-pentanyloxy)benzoate
Molecular Formula C14H20O3
Molecular Weight 236.31 g/mol
SMILES C(OCC)(=O)C1=CC=CC(OC(CC)CC)=C1
InChIKey MYVMYIHSZTVKQY-UHFFFAOYSA-N
Last Updated: 2026-03-29 08:05

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 3-(3-pentanyloxy)benzoate (CAS: 1151665-78-9)?

Ethyl 3-(3-pentanyloxy)benzoate (CAS: 1151665-78-9) is a crystalline compound with a molecular weigh...

Compound Q&A

How is Ethyl 3-(3-pentanyloxy)benzoate (CAS: 1151665-78-9) typically synthesized?

Ethyl 3-(3-pentanyloxy)benzoate (CAS: 1151665-78-9) is typically synthesized via a esterification re...

Compound Q&A

What precautions should be taken when handling Ethyl 3-(3-pentanyloxy)benzoate (CAS: 1151665-78-9)?

When handling Ethyl 3-(3-pentanyloxy)benzoate (CAS: 1151665-78-9), it is important to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...