Compound Q&A

What are the physical and chemical properties of Ethyl 3-(3-pentanyloxy)benzoate (CAS: 1151665-78-9)?

Answer

Ethyl 3-(3-pentanyloxy)benzoate
Ethyl 3-(3-pentanyloxy)benzoate (CAS: 1151665-78-9) is a crystalline compound with a molecular weight of approximately 228.3 g/mol. It has a melting point of around 57°C and is poorly soluble in water but soluble in common organic solvents. The compound exhibits good chemical stability, with limited reactivity under normal conditions. It shows low volatility and is not flammable. This compound is often used in applications requiring its specific functional groups and stability.

About

English Name Ethyl 3-(3-pentanyloxy)benzoate
Molecular Formula C14H20O3
Molecular Weight 236.31 g/mol
SMILES C(OCC)(=O)C1=CC=CC(OC(CC)CC)=C1
InChIKey MYVMYIHSZTVKQY-UHFFFAOYSA-N
Last Updated: 2026-03-29 08:05

Related Q&A

Compound Q&A

How is Ethyl 3-(3-pentanyloxy)benzoate (CAS: 1151665-78-9) typically synthesized?

Ethyl 3-(3-pentanyloxy)benzoate (CAS: 1151665-78-9) is typically synthesized via a esterification re...

Compound Q&A

What industries use Ethyl 3-(3-pentanyloxy)benzoate (CAS: 1151665-78-9)?

Ethyl 3-(3-pentanyloxy)benzoate (CAS: 1151665-78-9) is used in various industries, particularly in t...

Compound Q&A

What precautions should be taken when handling Ethyl 3-(3-pentanyloxy)benzoate (CAS: 1151665-78-9)?

When handling Ethyl 3-(3-pentanyloxy)benzoate (CAS: 1151665-78-9), it is important to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...