Compound Q&A

How is Ethyl 3-(3-pentanyloxy)benzoate (CAS: 1151665-78-9) typically synthesized?

Answer

Ethyl 3-(3-pentanyloxy)benzoate
Ethyl 3-(3-pentanyloxy)benzoate (CAS: 1151665-78-9) is typically synthesized via a esterification reaction between 3-pentanyloxybenzoic acid and ethyl alcohol, catalyzed by a solid acid like sulfuric acid. The reaction is carried out under mild conditions, and the yield is generally high due to the use of an efficient catalyst. The product is purified by recrystallization from an appropriate solvent.

About

English Name Ethyl 3-(3-pentanyloxy)benzoate
Molecular Formula C14H20O3
Molecular Weight 236.31 g/mol
SMILES C(OCC)(=O)C1=CC=CC(OC(CC)CC)=C1
InChIKey MYVMYIHSZTVKQY-UHFFFAOYSA-N
Last Updated: 2026-03-29 08:05

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 3-(3-pentanyloxy)benzoate (CAS: 1151665-78-9)?

Ethyl 3-(3-pentanyloxy)benzoate (CAS: 1151665-78-9) is a crystalline compound with a molecular weigh...

Compound Q&A

What industries use Ethyl 3-(3-pentanyloxy)benzoate (CAS: 1151665-78-9)?

Ethyl 3-(3-pentanyloxy)benzoate (CAS: 1151665-78-9) is used in various industries, particularly in t...

Compound Q&A

What precautions should be taken when handling Ethyl 3-(3-pentanyloxy)benzoate (CAS: 1151665-78-9)?

When handling Ethyl 3-(3-pentanyloxy)benzoate (CAS: 1151665-78-9), it is important to wear appropria...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...