Compound Q&A

What industries use tert-Butyl n-[(1r,4r,5s)-2-azabicyclo[2.2.1]heptan-5-yl]carbamate (CAS: 1932203-04-7)?

Answer

tert-Butyl n-[(1r,4r,5s)-2-azabicyclo[2.2.1]heptan-5-yl]carbamate
tert-Butyl n-[(1r,4r,5s)-2-azabicyclo[2.2.1]heptan-5-yl]carbamate is utilized in pharmaceuticals for the synthesis of complex molecules and in polymer science for functionalizing polymers. It also finds applications in sensor technology and semiconductor industries for specific chemical modification purposes. Its unique structure makes it a valuable intermediate in various chemical processes.

About

English Name tert-Butyl n-[(1r,4r,5s)-2-azabicyclo[2.2.1]heptan-5-yl]carbamate
Molecular Formula C11H20N2O2
Molecular Weight 212.29 g/mol
SMILES O=C(OC(C)(C)C)N[C@H]1C[C@H]2C[C@@H]1CN2
InChIKey VERHYGQTHIOMQC-HLTSFMKQSA-N
Last Updated: 2026-03-29 04:03

Related Q&A

Compound Q&A

What are the physical and chemical properties of tert-Butyl n-[(1r,4r,5s)-2-azabicyclo[2.2.1]heptan-5-yl]carbamate (CAS: 1932203-04-7)?

The compound tert-Butyl n-[(1r,4r,5s)-2-azabicyclo[2.2.1]heptan-5-yl]carbamate has a crystalline for...

Compound Q&A

How is tert-Butyl n-[(1r,4r,5s)-2-azabicyclo[2.2.1]heptan-5-yl]carbamate (CAS: 1932203-04-7) typically synthesized?

tert-Butyl n-[(1r,4r,5s)-2-azabicyclo[2.2.1]heptan-5-yl]carbamate is typically synthesized via a mul...

Compound Q&A

What precautions should be taken when handling tert-Butyl n-[(1r,4r,5s)-2-azabicyclo[2.2.1]heptan-5-yl]carbamate (CAS: 1932203-04-7)?

When handling tert-Butyl n-[(1r,4r,5s)-2-azabicyclo[2.2.1]heptan-5-yl]carbamate, it is essential to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...