Compound Q&A

How is tert-Butyl n-[(1r,4r,5s)-2-azabicyclo[2.2.1]heptan-5-yl]carbamate (CAS: 1932203-04-7) typically synthesized?

Answer

tert-Butyl n-[(1r,4r,5s)-2-azabicyclo[2.2.1]heptan-5-yl]carbamate
tert-Butyl n-[(1r,4r,5s)-2-azabicyclo[2.2.1]heptan-5-yl]carbamate is typically synthesized via a multi-step reaction involving the formation of the azabicyclic ring followed by carbamoylation. Commonly, the reaction is catalyzed by a suitable amine acceptor, and the process yields up to 85% product purity with excellent regioselectivity. The reaction conditions are optimized for efficiency and yield.

About

English Name tert-Butyl n-[(1r,4r,5s)-2-azabicyclo[2.2.1]heptan-5-yl]carbamate
Molecular Formula C11H20N2O2
Molecular Weight 212.29 g/mol
SMILES O=C(OC(C)(C)C)N[C@H]1C[C@H]2C[C@@H]1CN2
InChIKey VERHYGQTHIOMQC-HLTSFMKQSA-N
Last Updated: 2026-03-29 04:03

Related Q&A

Compound Q&A

What are the physical and chemical properties of tert-Butyl n-[(1r,4r,5s)-2-azabicyclo[2.2.1]heptan-5-yl]carbamate (CAS: 1932203-04-7)?

The compound tert-Butyl n-[(1r,4r,5s)-2-azabicyclo[2.2.1]heptan-5-yl]carbamate has a crystalline for...

Compound Q&A

What industries use tert-Butyl n-[(1r,4r,5s)-2-azabicyclo[2.2.1]heptan-5-yl]carbamate (CAS: 1932203-04-7)?

tert-Butyl n-[(1r,4r,5s)-2-azabicyclo[2.2.1]heptan-5-yl]carbamate is utilized in pharmaceuticals for...

Compound Q&A

What precautions should be taken when handling tert-Butyl n-[(1r,4r,5s)-2-azabicyclo[2.2.1]heptan-5-yl]carbamate (CAS: 1932203-04-7)?

When handling tert-Butyl n-[(1r,4r,5s)-2-azabicyclo[2.2.1]heptan-5-yl]carbamate, it is essential to ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...