Compound Q&A

What industries use 4-Chloro-4-phenyldihydro-2H-pyran-2,6(3H)-dione (CAS: 182955-12-0)?

Answer

4-Chloro-4-phenyldihydro-2H-pyran-2,6(3H)-dione
4-Chloro-4-phenyldihydro-2H-pyran-2,6(3H)-dione (CAS: 182955-12-0) is used in the pharmaceutical industry for the synthesis of certain drugs, particularly those involved in anti-inflammatory and analgesic applications. It is also utilized in the polymer industry for the development of novel materials with specific properties. Additionally, it has applications in sensor technology and semiconductor manufacturing due to its unique chemical reactivity.

About

English Name 4-Chloro-4-phenyldihydro-2H-pyran-2,6(3H)-dione
Molecular Formula C11H9ClO3
Molecular Weight 224.64299999999994 g/mol
EINECS 258-858-9
SMILES c1ccc(cc1)C2(CC(=O)OC(=O)C2)Cl
InChIKey VRXWKAZGXDFQHU-UHFFFAOYSA-N
Last Updated: 2026-03-29 04:03

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Chloro-4-phenyldihydro-2H-pyran-2,6(3H)-dione (CAS: 182955-12-0)?

4-Chloro-4-phenyldihydro-2H-pyran-2,6(3H)-dione (CAS: 182955-12-0) is a white to off-white crystalli...

Compound Q&A

How is 4-Chloro-4-phenyldihydro-2H-pyran-2,6(3H)-dione (CAS: 182955-12-0) typically synthesized?

4-Chloro-4-phenyldihydro-2H-pyran-2,6(3H)-dione (CAS: 182955-12-0) is typically synthesized via the ...

Compound Q&A

What precautions should be taken when handling 4-Chloro-4-phenyldihydro-2H-pyran-2,6(3H)-dione (CAS: 182955-12-0)?

When handling 4-Chloro-4-phenyldihydro-2H-pyran-2,6(3H)-dione (CAS: 182955-12-0), it is essential to...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...