Compound Q&A

How is 4-Chloro-4-phenyldihydro-2H-pyran-2,6(3H)-dione (CAS: 182955-12-0) typically synthesized?

Answer

4-Chloro-4-phenyldihydro-2H-pyran-2,6(3H)-dione
4-Chloro-4-phenyldihydro-2H-pyran-2,6(3H)-dione (CAS: 182955-12-0) is typically synthesized via the reaction of 4-chloro-1,3-dioxolan-2-one with phenylmagnesium bromide followed by acid work-up. The reaction is catalyzed by a strong base such as sodium hydride, and yields approximately 80-85% of the desired product. The method is selective and efficient for obtaining the compound in high purity.

About

English Name 4-Chloro-4-phenyldihydro-2H-pyran-2,6(3H)-dione
Molecular Formula C11H9ClO3
Molecular Weight 224.64299999999994 g/mol
EINECS 258-858-9
SMILES c1ccc(cc1)C2(CC(=O)OC(=O)C2)Cl
InChIKey VRXWKAZGXDFQHU-UHFFFAOYSA-N
Last Updated: 2026-03-29 04:03

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Chloro-4-phenyldihydro-2H-pyran-2,6(3H)-dione (CAS: 182955-12-0)?

4-Chloro-4-phenyldihydro-2H-pyran-2,6(3H)-dione (CAS: 182955-12-0) is a white to off-white crystalli...

Compound Q&A

What industries use 4-Chloro-4-phenyldihydro-2H-pyran-2,6(3H)-dione (CAS: 182955-12-0)?

4-Chloro-4-phenyldihydro-2H-pyran-2,6(3H)-dione (CAS: 182955-12-0) is used in the pharmaceutical ind...

Compound Q&A

What precautions should be taken when handling 4-Chloro-4-phenyldihydro-2H-pyran-2,6(3H)-dione (CAS: 182955-12-0)?

When handling 4-Chloro-4-phenyldihydro-2H-pyran-2,6(3H)-dione (CAS: 182955-12-0), it is essential to...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...