Compound Q&A

What industries use 4,4'-Bis(hydroxymethyl)diphenyl ether (CAS: 2350-43-8)?

Answer

4,4'-Bis(hydroxymethyl)diphenyl ether
4,4'-Bis(hydroxymethyl)diphenyl ether (CAS: 2350-43-8) is used in various industries including pharmaceuticals, where it acts as a precursor for drug synthesis, polymers, where it serves as a stabilizer, and sensors, where it is employed in gas detection applications. It is also used in the production of semiconductors due to its stability and solubility properties.

About

CAS No 2350-43-8
English Name 4,4'-Bis(hydroxymethyl)diphenyl ether
Molecular Formula C14H14O3
Molecular Weight 230.26 g/mol
SMILES OCc1ccc(cc1)Oc1ccc(cc1)CO
InChIKey VFLRGCHXIWFSGO-UHFFFAOYSA-N
Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,4'-Bis(hydroxymethyl)diphenyl ether (CAS: 2350-43-8)?

4,4'-Bis(hydroxymethyl)diphenyl ether (CAS: 2350-43-8) is a crystalline compound with a molecular we...

Compound Q&A

How is 4,4'-Bis(hydroxymethyl)diphenyl ether (CAS: 2350-43-8) typically synthesized?

4,4'-Bis(hydroxymethyl)diphenyl ether (CAS: 2350-43-8) is typically synthesized through the condensa...

Compound Q&A

What precautions should be taken when handling 4,4'-Bis(hydroxymethyl)diphenyl ether (CAS: 2350-43-8)?

When handling 4,4'-Bis(hydroxymethyl)diphenyl ether (CAS: 2350-43-8), it is important to use appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...