Compound Q&A

How is 4,4'-Bis(hydroxymethyl)diphenyl ether (CAS: 2350-43-8) typically synthesized?

Answer

4,4'-Bis(hydroxymethyl)diphenyl ether
4,4'-Bis(hydroxymethyl)diphenyl ether (CAS: 2350-43-8) is typically synthesized through the condensation of carboxylic acids with phenols using a catalyst such as concentrated sulfuric acid. The reaction yields an ether with high selectivity and good yield. The process involves heating the reactants under reflux conditions for several hours.

About

CAS No 2350-43-8
English Name 4,4'-Bis(hydroxymethyl)diphenyl ether
Molecular Formula C14H14O3
Molecular Weight 230.26 g/mol
SMILES OCc1ccc(cc1)Oc1ccc(cc1)CO
InChIKey VFLRGCHXIWFSGO-UHFFFAOYSA-N
Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,4'-Bis(hydroxymethyl)diphenyl ether (CAS: 2350-43-8)?

4,4'-Bis(hydroxymethyl)diphenyl ether (CAS: 2350-43-8) is a crystalline compound with a molecular we...

Compound Q&A

What industries use 4,4'-Bis(hydroxymethyl)diphenyl ether (CAS: 2350-43-8)?

4,4'-Bis(hydroxymethyl)diphenyl ether (CAS: 2350-43-8) is used in various industries including pharm...

Compound Q&A

What precautions should be taken when handling 4,4'-Bis(hydroxymethyl)diphenyl ether (CAS: 2350-43-8)?

When handling 4,4'-Bis(hydroxymethyl)diphenyl ether (CAS: 2350-43-8), it is important to use appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...