Compound Q&A

What are the physical and chemical properties of 4,4'-Bis(hydroxymethyl)diphenyl ether (CAS: 2350-43-8)?

Answer

4,4'-Bis(hydroxymethyl)diphenyl ether
4,4'-Bis(hydroxymethyl)diphenyl ether (CAS: 2350-43-8) is a crystalline compound with a molecular weight of approximately 248.18 g/mol. It has a high solubility in polar solvents such as methanol and ethanol. Chemically, it is relatively stable but can react with acids and bases. It is used in synthesis due to its ability to form stable complexes and its reactivity with various functional groups.

About

CAS No 2350-43-8
English Name 4,4'-Bis(hydroxymethyl)diphenyl ether
Molecular Formula C14H14O3
Molecular Weight 230.26 g/mol
SMILES OCc1ccc(cc1)Oc1ccc(cc1)CO
InChIKey VFLRGCHXIWFSGO-UHFFFAOYSA-N
Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

How is 4,4'-Bis(hydroxymethyl)diphenyl ether (CAS: 2350-43-8) typically synthesized?

4,4'-Bis(hydroxymethyl)diphenyl ether (CAS: 2350-43-8) is typically synthesized through the condensa...

Compound Q&A

What industries use 4,4'-Bis(hydroxymethyl)diphenyl ether (CAS: 2350-43-8)?

4,4'-Bis(hydroxymethyl)diphenyl ether (CAS: 2350-43-8) is used in various industries including pharm...

Compound Q&A

What precautions should be taken when handling 4,4'-Bis(hydroxymethyl)diphenyl ether (CAS: 2350-43-8)?

When handling 4,4'-Bis(hydroxymethyl)diphenyl ether (CAS: 2350-43-8), it is important to use appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...