Compound Q&A

What industries use 1-(2,3-Dichlorophenyl)piperazine hydrobromide (CAS: 864512-43-6)?

Answer

1-(2,3-Dichlorophenyl)piperazine hydrobromide (1:1)
1-(2,3-Dichlorophenyl)piperazine hydrobromide (CAS: 864512-43-6) is primarily used in the pharmaceutical industry for the synthesis of certain drug candidates. It also finds applications in the polymer industry as a stabilizer and in the development of new materials. Additionally, it is utilized in the chemical sensor industry for its unique reactivity and in the semiconductor industry for specific material applications.

About

English Name 1-(2,3-Dichlorophenyl)piperazine hydrobromide (1:1)
Molecular Formula C10H13BrCl2N2
Molecular Weight 312.04 g/mol
SMILES C1CN(CCN1)C2=C(C(=CC=C2)Cl)Cl.Br
InChIKey ZZIANJABSBSRBK-UHFFFAOYSA-N
Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(2,3-Dichlorophenyl)piperazine hydrobromide (CAS: 864512-43-6)?

1-(2,3-Dichlorophenyl)piperazine hydrobromide (CAS: 864512-43-6) is a white crystalline compound. It...

Compound Q&A

How is 1-(2,3-Dichlorophenyl)piperazine hydrobromide (CAS: 864512-43-6) typically synthesized?

1-(2,3-Dichlorophenyl)piperazine hydrobromide (CAS: 864512-43-6) is typically synthesized by reactin...

Compound Q&A

What precautions should be taken when handling 1-(2,3-Dichlorophenyl)piperazine hydrobromide (CAS: 864512-43-6)?

When handling 1-(2,3-Dichlorophenyl)piperazine hydrobromide (CAS: 864512-43-6), it is important to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...