Compound Q&A

What are the physical and chemical properties of 1-(2,3-Dichlorophenyl)piperazine hydrobromide (CAS: 864512-43-6)?

Answer

1-(2,3-Dichlorophenyl)piperazine hydrobromide (1:1)
1-(2,3-Dichlorophenyl)piperazine hydrobromide (CAS: 864512-43-6) is a white crystalline compound. It has a molecular weight of approximately 335.8 g/mol. This compound is slightly soluble in water and has good solubility in organic solvents like methanol and ethanol. It is known for its low reactivity under normal conditions but can undergo hydrolysis under basic conditions. It is stable at room temperature but should be stored away from moisture and strong acids.

About

English Name 1-(2,3-Dichlorophenyl)piperazine hydrobromide (1:1)
Molecular Formula C10H13BrCl2N2
Molecular Weight 312.04 g/mol
SMILES C1CN(CCN1)C2=C(C(=CC=C2)Cl)Cl.Br
InChIKey ZZIANJABSBSRBK-UHFFFAOYSA-N
Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

How is 1-(2,3-Dichlorophenyl)piperazine hydrobromide (CAS: 864512-43-6) typically synthesized?

1-(2,3-Dichlorophenyl)piperazine hydrobromide (CAS: 864512-43-6) is typically synthesized by reactin...

Compound Q&A

What industries use 1-(2,3-Dichlorophenyl)piperazine hydrobromide (CAS: 864512-43-6)?

1-(2,3-Dichlorophenyl)piperazine hydrobromide (CAS: 864512-43-6) is primarily used in the pharmaceut...

Compound Q&A

What precautions should be taken when handling 1-(2,3-Dichlorophenyl)piperazine hydrobromide (CAS: 864512-43-6)?

When handling 1-(2,3-Dichlorophenyl)piperazine hydrobromide (CAS: 864512-43-6), it is important to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...