Compound Q&A

How is 1-(2,3-Dichlorophenyl)piperazine hydrobromide (CAS: 864512-43-6) typically synthesized?

Answer

1-(2,3-Dichlorophenyl)piperazine hydrobromide (1:1)
1-(2,3-Dichlorophenyl)piperazine hydrobromide (CAS: 864512-43-6) is typically synthesized by reacting 1-(2,3-dichlorophenyl)piperazine with hydrobromic acid. The reaction is carried out in a suitable organic solvent under mild conditions. The yield is typically high, and the product can be isolated by recrystallization from an appropriate solvent.

About

English Name 1-(2,3-Dichlorophenyl)piperazine hydrobromide (1:1)
Molecular Formula C10H13BrCl2N2
Molecular Weight 312.04 g/mol
SMILES C1CN(CCN1)C2=C(C(=CC=C2)Cl)Cl.Br
InChIKey ZZIANJABSBSRBK-UHFFFAOYSA-N
Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(2,3-Dichlorophenyl)piperazine hydrobromide (CAS: 864512-43-6)?

1-(2,3-Dichlorophenyl)piperazine hydrobromide (CAS: 864512-43-6) is a white crystalline compound. It...

Compound Q&A

What industries use 1-(2,3-Dichlorophenyl)piperazine hydrobromide (CAS: 864512-43-6)?

1-(2,3-Dichlorophenyl)piperazine hydrobromide (CAS: 864512-43-6) is primarily used in the pharmaceut...

Compound Q&A

What precautions should be taken when handling 1-(2,3-Dichlorophenyl)piperazine hydrobromide (CAS: 864512-43-6)?

When handling 1-(2,3-Dichlorophenyl)piperazine hydrobromide (CAS: 864512-43-6), it is important to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...