Compound Q&A

What precautions should be taken when handling [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

Answer

[1,2,4]triazolo[3,4-a]phthalazine
When handling [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0), it is essential to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. This compound should be stored in a cool, dry place away from direct sunlight and flammable materials. In case of a spill, it should be cleaned up immediately following the safety data sheet (SDS) guidelines. Always ensure proper ventilation and use a fume hood for operations involving this compound to minimize inhalation risks.

About

CAS No 234-80-0
English Name [1,2,4]triazolo[3,4-a]phthalazine
Molecular Formula C9H6N4
Molecular Weight 170.175 g/mol
SMILES C1=CC=C2C(=C1)C=NN3C2=NN=C3
InChIKey JVJPJKLSGUJUJK-UHFFFAOYSA-N
Last Updated: 2026-03-28 19:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is a crystalline compound with a molecular weight ...

Compound Q&A

How is [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) typically synthesized?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is synthesized via the condensation of 1,2,4-triaz...

Compound Q&A

What industries use [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is utilized in the pharmaceutical industry due to ...

Compound Q&A

How is 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3) typically synthesized?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is typically s...

1187830-80-33-(2-Bromoimidazo[2,...
Compound Q&A

How is 2-Isopropyl-1,3-dioxane-5-carboxylic acid (CAS: 116193-72-7) typically synthesized?

2-Isopropyl-1,3-dioxane-5-carboxylic acid is typically synthesized by the carbox...

116193-72-72-Isopropyl-1,3-diox...
Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment ...

254435-95-5Alisporivir
Compound Q&A

What are the physical and chemical properties of [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is a crystalline compound with...

234-80-0[1,2,4]triazolo[3,4-...