Compound Q&A

How should Ethyl 2,8-dimethylquinoline-3-carboxylate (CAS: 392734-40-6) be stored?

Answer

Ethyl 2,8-dimethylquinoline-3-carboxylate
Ethyl 2,8-dimethylquinoline-3-carboxylate (CAS: 392734-40-6) should be stored in a cool, dry place away from direct sunlight and heat sources. It should be kept in a tightly sealed container to prevent degradation. Ideal storage conditions are below 25°C and with minimal humidity exposure to ensure its stability and safety.

About

English Name Ethyl 2,8-dimethylquinoline-3-carboxylate
Molecular Formula C14H15NO2
Molecular Weight 229.27899999999994 g/mol
SMILES CCOC(=O)C1=CC2=CC=CC(=C2N=C1C)C
InChIKey BRUBNQYCJAIYMR-UHFFFAOYSA-N
Last Updated: 2026-03-24 13:08

Related Q&A

Compound Q&A

What is Ethyl 2,8-dimethylquinoline-3-carboxylate (CAS: 392734-40-6)?

Ethyl 2,8-dimethylquinoline-3-carboxylate is a chemical compound with the CAS number 392734-40-6. It...

Compound Q&A

What are the main uses of Ethyl 2,8-dimethylquinoline-3-carboxylate (CAS: 392734-40-6)?

Ethyl 2,8-dimethylquinoline-3-carboxylate (CAS: 392734-40-6) is primarily used in the pharmaceutical...

Compound Q&A

Is Ethyl 2,8-dimethylquinoline-3-carboxylate (CAS: 392734-40-6) safe?

Ethyl 2,8-dimethylquinoline-3-carboxylate (CAS: 392734-40-6) is generally considered safe when handl...

Compound Q&A

How is 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3) typically synthesized?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is typically s...

1187830-80-33-(2-Bromoimidazo[2,...
Compound Q&A

How is 2-Isopropyl-1,3-dioxane-5-carboxylic acid (CAS: 116193-72-7) typically synthesized?

2-Isopropyl-1,3-dioxane-5-carboxylic acid is typically synthesized by the carbox...

116193-72-72-Isopropyl-1,3-diox...
Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment ...

254435-95-5Alisporivir
Compound Q&A

What are the physical and chemical properties of [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is a crystalline compound with...

234-80-0[1,2,4]triazolo[3,4-...