Compound Q&A

What are the main uses of Ethyl 2,8-dimethylquinoline-3-carboxylate (CAS: 392734-40-6)?

Answer

Ethyl 2,8-dimethylquinoline-3-carboxylate
Ethyl 2,8-dimethylquinoline-3-carboxylate (CAS: 392734-40-6) is primarily used in the pharmaceutical industry as an intermediate in the synthesis of other compounds. It is also utilized in research for its structural and chemical properties, and occasionally in the formulation of certain chemical products.

About

English Name Ethyl 2,8-dimethylquinoline-3-carboxylate
Molecular Formula C14H15NO2
Molecular Weight 229.27899999999994 g/mol
SMILES CCOC(=O)C1=CC2=CC=CC(=C2N=C1C)C
InChIKey BRUBNQYCJAIYMR-UHFFFAOYSA-N
Last Updated: 2026-03-24 13:08

Related Q&A

Compound Q&A

What is Ethyl 2,8-dimethylquinoline-3-carboxylate (CAS: 392734-40-6)?

Ethyl 2,8-dimethylquinoline-3-carboxylate is a chemical compound with the CAS number 392734-40-6. It...

Compound Q&A

Is Ethyl 2,8-dimethylquinoline-3-carboxylate (CAS: 392734-40-6) safe?

Ethyl 2,8-dimethylquinoline-3-carboxylate (CAS: 392734-40-6) is generally considered safe when handl...

Compound Q&A

How should Ethyl 2,8-dimethylquinoline-3-carboxylate (CAS: 392734-40-6) be stored?

Ethyl 2,8-dimethylquinoline-3-carboxylate (CAS: 392734-40-6) should be stored in a cool, dry place a...

Compound Q&A

How is 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3) typically synthesized?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is typically s...

1187830-80-33-(2-Bromoimidazo[2,...
Compound Q&A

How is 2-Isopropyl-1,3-dioxane-5-carboxylic acid (CAS: 116193-72-7) typically synthesized?

2-Isopropyl-1,3-dioxane-5-carboxylic acid is typically synthesized by the carbox...

116193-72-72-Isopropyl-1,3-diox...
Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment ...

254435-95-5Alisporivir
Compound Q&A

What are the physical and chemical properties of [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is a crystalline compound with...

234-80-0[1,2,4]triazolo[3,4-...