Compound Q&A

What precautions should be taken when handling Artelinic acid (CAS: 120020-26-0)?

Answer

Artelinic acid
When handling Artelinic acid (CAS: 120020-26-0), it is crucial to wear appropriate personal protective equipment (PPE) such as gloves and safety goggles. It should be handled in a well-ventilated area or fume hood. Spills should be cleaned up immediately using appropriate procedures, and the material safety data sheet (MSDS) should be consulted for detailed information on safe handling and disposal.

About

English Name Artelinic acid
Molecular Formula C23H30O7
Molecular Weight 418.5 g/mol
SMILES CC1CCC2C(C(OC3C24C1CCC(O3)(OO4)C)OCC5=CC=C(C=C5)C(=O)O)C
InChIKey UVNHKOOJXSALHN-ILQPJIFQSA-N
Last Updated: 2026-03-23 12:56

Related Q&A

Compound Q&A

What are the physical and chemical properties of Artelinic acid (CAS: 120020-26-0)?

Artelinic acid (CAS: 120020-26-0) is a crystalline solid with a molecular weight of approximately 35...

Compound Q&A

How is Artelinic acid (CAS: 120020-26-0) typically synthesized?

Artelinic acid (CAS: 120020-26-0) is typically synthesized via condensation reactions of carboxylic ...

Compound Q&A

What industries use Artelinic acid (CAS: 120020-26-0)?

Artelinic acid (CAS: 120020-26-0) is used in the pharmaceutical industry for drug synthesis. It also...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...
Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...
Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...