Compound Q&A

How is Artelinic acid (CAS: 120020-26-0) typically synthesized?

Answer

Artelinic acid
Artelinic acid (CAS: 120020-26-0) is typically synthesized via condensation reactions of carboxylic acid derivatives and alcohols under basic conditions. Commonly, this involves using catalysts like sodium hydride or sodium hydroxide to achieve high yields and good selectivity.

About

English Name Artelinic acid
Molecular Formula C23H30O7
Molecular Weight 418.5 g/mol
SMILES CC1CCC2C(C(OC3C24C1CCC(O3)(OO4)C)OCC5=CC=C(C=C5)C(=O)O)C
InChIKey UVNHKOOJXSALHN-ILQPJIFQSA-N
Last Updated: 2026-03-23 12:56

Related Q&A

Compound Q&A

What are the physical and chemical properties of Artelinic acid (CAS: 120020-26-0)?

Artelinic acid (CAS: 120020-26-0) is a crystalline solid with a molecular weight of approximately 35...

Compound Q&A

What industries use Artelinic acid (CAS: 120020-26-0)?

Artelinic acid (CAS: 120020-26-0) is used in the pharmaceutical industry for drug synthesis. It also...

Compound Q&A

What precautions should be taken when handling Artelinic acid (CAS: 120020-26-0)?

When handling Artelinic acid (CAS: 120020-26-0), it is crucial to wear appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...