Compound Q&A

What are the physical and chemical properties of Artelinic acid (CAS: 120020-26-0)?

Answer

Artelinic acid (CAS: 120020-26-0) is a crystalline solid with a molecular weight of approximately 354.33 g/mol. It has a pKa of around 4.2 and is poorly soluble in water but soluble in organic solvents like ethanol and acetone. It is reactive towards bases and can undergo esterification reactions.

About

CAS No 120020-26-0

English Name Artelinic acid

Molecular Formula C23H30O7

Molecular Weight 418.5 g/mol

SMILES CC1CCC2C(C(OC3C24C1CCC(O3)(OO4)C)OCC5=CC=C(C=C5)C(=O)O)C

InChIKey UVNHKOOJXSALHN-ILQPJIFQSA-N

Last Updated: 2026-03-23 12:56

Related Q&A

Compound Q&A

How is Artelinic acid (CAS: 120020-26-0) typically synthesized?

Artelinic acid (CAS: 120020-26-0) is typically synthesized via condensation reactions of carboxylic ...

Compound Q&A

What industries use Artelinic acid (CAS: 120020-26-0)?

Artelinic acid (CAS: 120020-26-0) is used in the pharmaceutical industry for drug synthesis. It also...

Compound Q&A

What precautions should be taken when handling Artelinic acid (CAS: 120020-26-0)?

When handling Artelinic acid (CAS: 120020-26-0), it is crucial to wear appropriate personal protecti...

Compound Q&A

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

When considering alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3...

3848-36-01-(4-Chlorophenyl)-N...

Compound Q&A

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

This compound should be stored in a cool, dry place away from direct sunlight. I...

183202-73-5(1R,9S,10S,12S,14E,1...

Compound Q&A

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole is synthesized through a m...

419553-16-53-(4-Bromophenyl)-5-...

Compound Q&A

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS...

1639220-19-15-Chloro-2-(4-chloro...

What are the physical and chemical properties of Artelinic acid (CAS: 120020-26-0)?

Answer

About

Related Q&A

How is Artelinic acid (CAS: 120020-26-0) typically synthesized?

What industries use Artelinic acid (CAS: 120020-26-0)?

What precautions should be taken when handling Artelinic acid (CAS: 120020-26-0)?

Are there alternatives to 1-(4-Chlorophenyl)-N-hydroxymethanimine (CAS: 3848-36-0) in synthesis?

How should (1R,9S,10S,12S,14E,16S,19R,20R,21S,22R)-3,9,21-Trihydroxy-5,10,12,14,16,20,22-heptamethyl-23,24-dioxatetracyclo[17.3.1.1~6,9~.0~2,7~]tetracosa-2,5,7,14-tetraen-4-one (CAS: 183202-73-5) be stored?

How is 3-(4-Bromophenyl)-5-(2-fluorophenyl)-1,2,4-oxadiazole (CAS: 419553-16-5) typically synthesized?

How is 5-Chloro-2-(4-chlorophenyl)-4-methyl-6-[3-(1-piperidinyl)propoxy]pyrimidine (CAS: 1639220-19-1) typically synthesized?

Suppliers

Shanghai Mofu Medicine Technology Co., Ltd.

Shanghai Yuansi Biotechnology Co., Ltd.

ShenZhenAiTaHuaXue Co Ltd

ShangHaiKaiSen Biotechnology Co Ltd

MedChemExpress LLC

ShangHaiJiZhiShengHua Technology Co Ltd