Compound Q&A

What are the physical and chemical properties of Artelinic acid (CAS: 120020-26-0)?

Answer

Artelinic acid
Artelinic acid (CAS: 120020-26-0) is a crystalline solid with a molecular weight of approximately 354.33 g/mol. It has a pKa of around 4.2 and is poorly soluble in water but soluble in organic solvents like ethanol and acetone. It is reactive towards bases and can undergo esterification reactions.

About

English Name Artelinic acid
Molecular Formula C23H30O7
Molecular Weight 418.5 g/mol
SMILES CC1CCC2C(C(OC3C24C1CCC(O3)(OO4)C)OCC5=CC=C(C=C5)C(=O)O)C
InChIKey UVNHKOOJXSALHN-ILQPJIFQSA-N
Last Updated: 2026-03-23 12:56

Related Q&A

Compound Q&A

How is Artelinic acid (CAS: 120020-26-0) typically synthesized?

Artelinic acid (CAS: 120020-26-0) is typically synthesized via condensation reactions of carboxylic ...

Compound Q&A

What industries use Artelinic acid (CAS: 120020-26-0)?

Artelinic acid (CAS: 120020-26-0) is used in the pharmaceutical industry for drug synthesis. It also...

Compound Q&A

What precautions should be taken when handling Artelinic acid (CAS: 120020-26-0)?

When handling Artelinic acid (CAS: 120020-26-0), it is crucial to wear appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...