Compound Q&A

What precautions should be taken when handling 4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0)?

Answer

4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine
When handling 4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0), it is crucial to wear appropriate personal protective equipment (PPE), including gloves, safety goggles, and a lab coat. This compound should be handled in a well-ventilated area or a fume hood. In the event of a spill, it should be cleaned up immediately using appropriate spill response materials. Always refer to the Material Safety Data Sheet (MSDS) for detailed safety information and emergency procedures.

About

English Name 4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine
Molecular Formula C22H16N4
Molecular Weight 336.398 g/mol
SMILES n1ccc(cc1)C(=C(c1ccncc1)c1ccncc1)c1ccncc1
InChIKey ZTIDKYAFTJKSNT-UHFFFAOYSA-N
Last Updated: 2026-03-23 08:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0)?

4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0) is a crystalline compound wit...

Compound Q&A

How is 4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0) typically synthesized?

4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine is typically synthesized through the condensation...

Compound Q&A

What industries use 4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0)?

4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0) is primarily used in the phar...

Compound Q&A

What are the physical and chemical properties of 4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0)?

4,4',4'',4'''-(1,1,2,2-Ethenetetrayl)tetrapyridine (CAS: 2040295-11-0) is a crys...

2040295-11-04,4',4'',4'''-(1,1,2...
Compound Q&A

Are there alternatives to (3beta)-Abieta-8,11,13-triene-3,12-diol (CAS: 564-73-8) in synthesis?

There are several alternatives to (3beta)-Abieta-8,11,13-triene-3,12-diol in syn...

564-73-8(3beta)-Abieta-8,11,...
Compound Q&A

What are the main uses of sec-Butylhydrazine dihydrochloride (CAS: 1177361-36-2)?

Sec-Butylhydrazine dihydrochloride is mainly used as a precursor in the synthesi...

1177361-36-2sec-Butylhydrazine d...
Compound Q&A

How is BIBP3226 TFA (CAS: 1068148-47-9) typically synthesized?

BIBP3226 TFA is synthesized via a multi-step process involving amino acid deriva...

1068148-47-9BIBP3226 TFA