Compound Q&A

What precautions should be taken when handling artemisinic acid (CAS: 8028-66-8)?

Answer

Artemisinic acid
When handling artemisinic acid (CAS: 8028-66-8), it is essential to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood to minimize inhalation risks. Spills should be cleaned up using appropriate absorbents, and the area should be thoroughly decontaminated. Always refer to the safety data sheet (SDS) for detailed handling and emergency procedures.

About

CAS No 8028-66-8
English Name Artemisinic acid
Molecular Formula C15H22O2
Molecular Weight 234.33 g/mol
SMILES OC(C(=C)[C@@H]1CC[C@@H](C)[C@@H]2CCC(C)=C[C@@H]21)=O
InChIKey PLQMEXSCSAIXGB-SAXRGWBVSA-N
Last Updated: 2026-03-23 08:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of artemisinic acid (CAS: 8028-66-8)?

Artemisinic acid (CAS: 8028-66-8) is a crystalline compound with a molecular weight of approximately...

Compound Q&A

How is artemisinic acid (CAS: 8028-66-8) typically synthesized?

Artemisinic acid is typically synthesized via a multi-step process that involves the oxidation of ar...

Compound Q&A

What industries use artemisinic acid (CAS: 8028-66-8)?

Artemisinic acid finds significant use in the pharmaceutical industry, particularly in the productio...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...