Compound Q&A

What are the physical and chemical properties of artemisinic acid (CAS: 8028-66-8)?

Answer

Artemisinic acid
Artemisinic acid (CAS: 8028-66-8) is a crystalline compound with a molecular weight of approximately 282.36 g/mol. It is poorly soluble in water but soluble in organic solvents like ethanol and acetone. It exhibits limited reactivity with common reagents, making it suitable for various chemical transformations. Its melting point is around 140-145°C.

About

CAS No 8028-66-8
English Name Artemisinic acid
Molecular Formula C15H22O2
Molecular Weight 234.33 g/mol
SMILES OC(C(=C)[C@@H]1CC[C@@H](C)[C@@H]2CCC(C)=C[C@@H]21)=O
InChIKey PLQMEXSCSAIXGB-SAXRGWBVSA-N
Last Updated: 2026-03-23 08:16

Related Q&A

Compound Q&A

How is artemisinic acid (CAS: 8028-66-8) typically synthesized?

Artemisinic acid is typically synthesized via a multi-step process that involves the oxidation of ar...

Compound Q&A

What industries use artemisinic acid (CAS: 8028-66-8)?

Artemisinic acid finds significant use in the pharmaceutical industry, particularly in the productio...

Compound Q&A

What precautions should be taken when handling artemisinic acid (CAS: 8028-66-8)?

When handling artemisinic acid (CAS: 8028-66-8), it is essential to wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...