Compound Q&A

How is artemisinic acid (CAS: 8028-66-8) typically synthesized?

Answer

Artemisinic acid
Artemisinic acid is typically synthesized via a multi-step process that involves the oxidation of artocarpus lactone. This process often uses palladium catalysts and is optimized for high selectivity and yield. Common methods include air oxidation and catalytic hydrogen peroxide oxidation, leading to the formation of artemisinic acid with a yield of up to 70%.

About

CAS No 8028-66-8
English Name Artemisinic acid
Molecular Formula C15H22O2
Molecular Weight 234.33 g/mol
SMILES OC(C(=C)[C@@H]1CC[C@@H](C)[C@@H]2CCC(C)=C[C@@H]21)=O
InChIKey PLQMEXSCSAIXGB-SAXRGWBVSA-N
Last Updated: 2026-03-23 08:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of artemisinic acid (CAS: 8028-66-8)?

Artemisinic acid (CAS: 8028-66-8) is a crystalline compound with a molecular weight of approximately...

Compound Q&A

What industries use artemisinic acid (CAS: 8028-66-8)?

Artemisinic acid finds significant use in the pharmaceutical industry, particularly in the productio...

Compound Q&A

What precautions should be taken when handling artemisinic acid (CAS: 8028-66-8)?

When handling artemisinic acid (CAS: 8028-66-8), it is essential to wear appropriate personal protec...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...