Compound Q&A

How is (1R,4R)-2-Azabicyclo[2.2.1]heptane-2-carboxylic acid, 5-oxo-, 1,1-dimethylethyl ester (CAS: 1400808-00-5) typically synthesized?

Answer

2-Azabicyclo[2.2.1]heptane-2-carboxylic acid, 5-oxo-, 1,1-dimethylethyl ester, (1R,4R)-
(1R,4R)-2-Azabicyclo[2.2.1]heptane-2-carboxylic acid, 5-oxo-, 1,1-dimethylethyl ester can be synthesized via a multistep process involving the formation of the azabicyclic ring, followed by functionalization with a carboxylic group, and esterification with 1,1-dimethylethyl alcohol. The synthesis typically involves the use of reagents such as phthalimide and sodium hydride, and is performed under mild to moderate conditions.

About

English Name 2-Azabicyclo[2.2.1]heptane-2-carboxylic acid, 5-oxo-, 1,1-dimethylethyl ester, (1R,4R)-
Molecular Formula C11H17NO3
Molecular Weight 211.26 g/mol
SMILES CC(C)(C)OC(=O)N1CC2CC1CC2=O
InChIKey YGENGNQEVDONGO-UHFFFAOYSA-N
Last Updated: 2026-03-23 08:16

Related Q&A

Compound Q&A

What are the physical and chemical properties of (1R,4R)-2-Azabicyclo[2.2.1]heptane-2-carboxylic acid, 5-oxo-, 1,1-dimethylethyl ester (CAS: 1400808-00-5)?

(1R,4R)-2-Azabicyclo[2.2.1]heptane-2-carboxylic acid, 5-oxo-, 1,1-dimethylethyl ester is a white cry...

Compound Q&A

What industries use (1R,4R)-2-Azabicyclo[2.2.1]heptane-2-carboxylic acid, 5-oxo-, 1,1-dimethylethyl ester (CAS: 1400808-00-5)?

(1R,4R)-2-Azabicyclo[2.2.1]heptane-2-carboxylic acid, 5-oxo-, 1,1-dimethylethyl ester is primarily u...

Compound Q&A

What precautions should be taken when handling (1R,4R)-2-Azabicyclo[2.2.1]heptane-2-carboxylic acid, 5-oxo-, 1,1-dimethylethyl ester (CAS: 1400808-00-5)?

Handling (1R,4R)-2-Azabicyclo[2.2.1]heptane-2-carboxylic acid, 5-oxo-, 1,1-dimethylethyl ester requi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...