Compound Q&A

What are the physical and chemical properties of (1R,4R)-2-Azabicyclo[2.2.1]heptane-2-carboxylic acid, 5-oxo-, 1,1-dimethylethyl ester (CAS: 1400808-00-5)?

Answer

2-Azabicyclo[2.2.1]heptane-2-carboxylic acid, 5-oxo-, 1,1-dimethylethyl ester, (1R,4R)-
(1R,4R)-2-Azabicyclo[2.2.1]heptane-2-carboxylic acid, 5-oxo-, 1,1-dimethylethyl ester is a white crystalline solid with a molecular weight of approximately 258.34 g/mol. It has limited water solubility but good solubility in organic solvents such as dichloromethane and ethanol. Chemically, it shows reactivity typical of carboxylic acid esters, including esterification and hydrolysis reactions.

About

English Name 2-Azabicyclo[2.2.1]heptane-2-carboxylic acid, 5-oxo-, 1,1-dimethylethyl ester, (1R,4R)-
Molecular Formula C11H17NO3
Molecular Weight 211.26 g/mol
SMILES CC(C)(C)OC(=O)N1CC2CC1CC2=O
InChIKey YGENGNQEVDONGO-UHFFFAOYSA-N
Last Updated: 2026-03-23 08:16

Related Q&A

Compound Q&A

How is (1R,4R)-2-Azabicyclo[2.2.1]heptane-2-carboxylic acid, 5-oxo-, 1,1-dimethylethyl ester (CAS: 1400808-00-5) typically synthesized?

(1R,4R)-2-Azabicyclo[2.2.1]heptane-2-carboxylic acid, 5-oxo-, 1,1-dimethylethyl ester can be synthes...

Compound Q&A

What industries use (1R,4R)-2-Azabicyclo[2.2.1]heptane-2-carboxylic acid, 5-oxo-, 1,1-dimethylethyl ester (CAS: 1400808-00-5)?

(1R,4R)-2-Azabicyclo[2.2.1]heptane-2-carboxylic acid, 5-oxo-, 1,1-dimethylethyl ester is primarily u...

Compound Q&A

What precautions should be taken when handling (1R,4R)-2-Azabicyclo[2.2.1]heptane-2-carboxylic acid, 5-oxo-, 1,1-dimethylethyl ester (CAS: 1400808-00-5)?

Handling (1R,4R)-2-Azabicyclo[2.2.1]heptane-2-carboxylic acid, 5-oxo-, 1,1-dimethylethyl ester requi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...