Compound Q&A

What precautions should be taken when handling N-[(1R)-1-(5-Chloro-2-hydroxyphenyl)ethyl]-4-methylbenzenesulfonamide (CAS: 1421840-44-9)?

Answer

N-[(1R)-1-(5-Chloro-2-hydroxyphenyl)ethyl]-4-methylbenzenesulfonamide
When handling N-[(1R)-1-(5-Chloro-2-hydroxyphenyl)ethyl]-4-methylbenzenesulfonamide (CAS: 1421840-44-9), wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Store the compound in a cool, dry place away from sources of heat and light. Use a fume hood during handling to minimize inhalation risk. In case of spill, follow standard safety protocols and consult the safety data sheet (SDS) for specific instructions.

About

English Name N-[(1R)-1-(5-Chloro-2-hydroxyphenyl)ethyl]-4-methylbenzenesulfonamide
Molecular Formula C15H16ClNO3S
Molecular Weight 325.81 g/mol
SMILES Cc1ccc(cc1)S(=O)(=O)N[C@H](C)c2cc(ccc2O)Cl
InChIKey SCQIHZBVQHRKIF-LLVKDONJSA-N
Last Updated: 2026-03-23 04:12

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-[(1R)-1-(5-Chloro-2-hydroxyphenyl)ethyl]-4-methylbenzenesulfonamide (CAS: 1421840-44-9)?

N-[(1R)-1-(5-Chloro-2-hydroxyphenyl)ethyl]-4-methylbenzenesulfonamide (CAS: 1421840-44-9) is a cryst...

Compound Q&A

How is N-[(1R)-1-(5-Chloro-2-hydroxyphenyl)ethyl]-4-methylbenzenesulfonamide (CAS: 1421840-44-9) typically synthesized?

N-[(1R)-1-(5-Chloro-2-hydroxyphenyl)ethyl]-4-methylbenzenesulfonamide (CAS: 1421840-44-9) is typical...

Compound Q&A

What industries use N-[(1R)-1-(5-Chloro-2-hydroxyphenyl)ethyl]-4-methylbenzenesulfonamide (CAS: 1421840-44-9)?

N-[(1R)-1-(5-Chloro-2-hydroxyphenyl)ethyl]-4-methylbenzenesulfonamide (CAS: 1421840-44-9) is used in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...