Compound Q&A

What industries use Methyl 3-nitro-2-thiophenecarboxylate (CAS: 75735-44-3)?

Answer

Methyl 3-nitro-2-thiophenecarboxylate
Methyl 3-nitro-2-thiophenecarboxylate (CAS: 75735-44-3) is primarily used in the pharmaceutical and polymer industries. It serves as an intermediate in the synthesis of various drugs and is also employed in the production of specialty polymers and materials with unique electronic and optical properties.

About

CAS No 75735-44-3
English Name Methyl 3-nitro-2-thiophenecarboxylate
Molecular Formula C6H5NO4S
Molecular Weight 187.17 g/mol
SMILES COC(=O)C1=C(C=CS1)[N+](=O)[O-]
InChIKey DDLFZCCIZTVFBQ-UHFFFAOYSA-N
Last Updated: 2026-03-23 00:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Methyl 3-nitro-2-thiophenecarboxylate (CAS: 75735-44-3)?

Methyl 3-nitro-2-thiophenecarboxylate (CAS: 75735-44-3) is a crystalline solid with a molecular weig...

Compound Q&A

How is Methyl 3-nitro-2-thiophenecarboxylate (CAS: 75735-44-3) typically synthesized?

Methyl 3-nitro-2-thiophenecarboxylate (CAS: 75735-44-3) is commonly synthesized via the nitration of...

Compound Q&A

What precautions should be taken when handling Methyl 3-nitro-2-thiophenecarboxylate (CAS: 75735-44-3)?

When handling Methyl 3-nitro-2-thiophenecarboxylate (CAS: 75735-44-3), it is crucial to wear appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...