Compound Q&A

What are the physical and chemical properties of Methyl 3-nitro-2-thiophenecarboxylate (CAS: 75735-44-3)?

Answer

Methyl 3-nitro-2-thiophenecarboxylate
Methyl 3-nitro-2-thiophenecarboxylate (CAS: 75735-44-3) is a crystalline solid with a molecular weight of approximately 214.09 g/mol. It has a low solubility in water but is soluble in common organic solvents like ethanol and acetone. This compound is known for its reactivity, particularly towards nucleophiles and reducing agents, making it useful in various organic synthesis reactions.

About

CAS No 75735-44-3
English Name Methyl 3-nitro-2-thiophenecarboxylate
Molecular Formula C6H5NO4S
Molecular Weight 187.17 g/mol
SMILES COC(=O)C1=C(C=CS1)[N+](=O)[O-]
InChIKey DDLFZCCIZTVFBQ-UHFFFAOYSA-N
Last Updated: 2026-03-23 00:14

Related Q&A

Compound Q&A

How is Methyl 3-nitro-2-thiophenecarboxylate (CAS: 75735-44-3) typically synthesized?

Methyl 3-nitro-2-thiophenecarboxylate (CAS: 75735-44-3) is commonly synthesized via the nitration of...

Compound Q&A

What industries use Methyl 3-nitro-2-thiophenecarboxylate (CAS: 75735-44-3)?

Methyl 3-nitro-2-thiophenecarboxylate (CAS: 75735-44-3) is primarily used in the pharmaceutical and ...

Compound Q&A

What precautions should be taken when handling Methyl 3-nitro-2-thiophenecarboxylate (CAS: 75735-44-3)?

When handling Methyl 3-nitro-2-thiophenecarboxylate (CAS: 75735-44-3), it is crucial to wear appropr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...