Compound Q&A

What industries use 8-Bromo-3-chloro-5-isopropylisoquinoline (CAS: 2660255-85-4)?

Answer

8-Bromo-3-chloro-5-isopropylisoquinoline
8-Bromo-3-chloro-5-isopropylisoquinoline is used in the pharmaceutical industry for the synthesis of various compounds. It is also explored in the chemical sensor industry for its ability to detect specific gases. Additionally, it has applications in the semiconductor industry for certain chemical processes.

About

English Name 8-Bromo-3-chloro-5-isopropylisoquinoline
Molecular Formula C12H11BrClN
Molecular Weight 284.58 g/mol
SMILES CC(C)c1ccc(Br)c2cnc(Cl)cc12
InChIKey GUZXCNBBJSVUBW-UHFFFAOYSA-N
Last Updated: 2026-03-23 00:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 8-Bromo-3-chloro-5-isopropylisoquinoline (CAS: 2660255-85-4)?

8-Bromo-3-chloro-5-isopropylisoquinoline is a solid with a crystalline form. Its molecular weight is...

Compound Q&A

How is 8-Bromo-3-chloro-5-isopropylisoquinoline (CAS: 2660255-85-4) typically synthesized?

8-Bromo-3-chloro-5-isopropylisoquinoline is synthesized by bromination of 3-chloro-5-isopropylisoqui...

Compound Q&A

What precautions should be taken when handling 8-Bromo-3-chloro-5-isopropylisoquinoline (CAS: 2660255-85-4)?

When handling 8-Bromo-3-chloro-5-isopropylisoquinoline, it is crucial to use personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...