Compound Q&A

What are the physical and chemical properties of 8-Bromo-3-chloro-5-isopropylisoquinoline (CAS: 2660255-85-4)?

Answer

8-Bromo-3-chloro-5-isopropylisoquinoline
8-Bromo-3-chloro-5-isopropylisoquinoline is a solid with a crystalline form. Its molecular weight is approximately 297.01 g/mol. This compound is slightly soluble in water but more soluble in organic solvents like ethanol and acetone. Chemically, it is reactive towards nucleophiles and can undergo substitution reactions. It is not flammable but can react with strong oxidizers.

About

English Name 8-Bromo-3-chloro-5-isopropylisoquinoline
Molecular Formula C12H11BrClN
Molecular Weight 284.58 g/mol
SMILES CC(C)c1ccc(Br)c2cnc(Cl)cc12
InChIKey GUZXCNBBJSVUBW-UHFFFAOYSA-N
Last Updated: 2026-03-23 00:14

Related Q&A

Compound Q&A

How is 8-Bromo-3-chloro-5-isopropylisoquinoline (CAS: 2660255-85-4) typically synthesized?

8-Bromo-3-chloro-5-isopropylisoquinoline is synthesized by bromination of 3-chloro-5-isopropylisoqui...

Compound Q&A

What industries use 8-Bromo-3-chloro-5-isopropylisoquinoline (CAS: 2660255-85-4)?

8-Bromo-3-chloro-5-isopropylisoquinoline is used in the pharmaceutical industry for the synthesis of...

Compound Q&A

What precautions should be taken when handling 8-Bromo-3-chloro-5-isopropylisoquinoline (CAS: 2660255-85-4)?

When handling 8-Bromo-3-chloro-5-isopropylisoquinoline, it is crucial to use personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...