Compound Q&A

How is 8-Bromo-3-chloro-5-isopropylisoquinoline (CAS: 2660255-85-4) typically synthesized?

Answer

8-Bromo-3-chloro-5-isopropylisoquinoline
8-Bromo-3-chloro-5-isopropylisoquinoline is synthesized by bromination of 3-chloro-5-isopropylisoquinoline followed by bromination. The reaction is catalyzed by a Lewis acid such as aluminum bromide. The yield is typically around 70-80%, with high selectivity for the bromine substitution. The reaction is carried out under anhydrous conditions to avoid side reactions.

About

English Name 8-Bromo-3-chloro-5-isopropylisoquinoline
Molecular Formula C12H11BrClN
Molecular Weight 284.58 g/mol
SMILES CC(C)c1ccc(Br)c2cnc(Cl)cc12
InChIKey GUZXCNBBJSVUBW-UHFFFAOYSA-N
Last Updated: 2026-03-23 00:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of 8-Bromo-3-chloro-5-isopropylisoquinoline (CAS: 2660255-85-4)?

8-Bromo-3-chloro-5-isopropylisoquinoline is a solid with a crystalline form. Its molecular weight is...

Compound Q&A

What industries use 8-Bromo-3-chloro-5-isopropylisoquinoline (CAS: 2660255-85-4)?

8-Bromo-3-chloro-5-isopropylisoquinoline is used in the pharmaceutical industry for the synthesis of...

Compound Q&A

What precautions should be taken when handling 8-Bromo-3-chloro-5-isopropylisoquinoline (CAS: 2660255-85-4)?

When handling 8-Bromo-3-chloro-5-isopropylisoquinoline, it is crucial to use personal protective equ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...