Compound Q&A

What industries use Phosphonium, triphenyl(phenylmethyl)- (CAS: 15853-35-7)?

Answer

Phosphonium, triphenyl(phenylmethyl)-
Phosphonium, triphenyl(phenylmethyl)- (CAS: 15853-35-7) is primarily used in the pharmaceutical, polymer, and semiconductor industries. It serves as a key reagent in the synthesis of various organic compounds, polymers, and catalysts for semiconductors. Its unique properties make it valuable in these fields for its reactivity and stability.

About

CAS No 15853-35-7
English Name Phosphonium, triphenyl(phenylmethyl)-
Molecular Formula C25H22P+
Molecular Weight 353.4 g/mol
SMILES C1=CC=C(C=C1)C[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4
InChIKey BNQRPLGZFADFGA-UHFFFAOYSA-N
Last Updated: 2026-03-23 00:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Phosphonium, triphenyl(phenylmethyl)- (CAS: 15853-35-7)?

Phosphonium, triphenyl(phenylmethyl)- (CAS: 15853-35-7) is a solid with a crystalline form. Its mole...

Compound Q&A

How is Phosphonium, triphenyl(phenylmethyl)- (CAS: 15853-35-7) typically synthesized?

Phosphonium, triphenyl(phenylmethyl)- (CAS: 15853-35-7) can be synthesized via the reaction of triph...

Compound Q&A

What precautions should be taken when handling Phosphonium, triphenyl(phenylmethyl)- (CAS: 15853-35-7)?

When handling Phosphonium, triphenyl(phenylmethyl)- (CAS: 15853-35-7), it is essential to use person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...