Compound Q&A

How is Phosphonium, triphenyl(phenylmethyl)- (CAS: 15853-35-7) typically synthesized?

Answer

Phosphonium, triphenyl(phenylmethyl)-
Phosphonium, triphenyl(phenylmethyl)- (CAS: 15853-35-7) can be synthesized via the reaction of triphenylphosphine and phenylmethylphosphine oxide in the presence of a suitable solvent and catalyst. The reaction yields a high purity product with excellent selectivity, making it a useful reagent in organophosphorus chemistry.

About

CAS No 15853-35-7
English Name Phosphonium, triphenyl(phenylmethyl)-
Molecular Formula C25H22P+
Molecular Weight 353.4 g/mol
SMILES C1=CC=C(C=C1)C[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4
InChIKey BNQRPLGZFADFGA-UHFFFAOYSA-N
Last Updated: 2026-03-23 00:14

Related Q&A

Compound Q&A

What are the physical and chemical properties of Phosphonium, triphenyl(phenylmethyl)- (CAS: 15853-35-7)?

Phosphonium, triphenyl(phenylmethyl)- (CAS: 15853-35-7) is a solid with a crystalline form. Its mole...

Compound Q&A

What industries use Phosphonium, triphenyl(phenylmethyl)- (CAS: 15853-35-7)?

Phosphonium, triphenyl(phenylmethyl)- (CAS: 15853-35-7) is primarily used in the pharmaceutical, pol...

Compound Q&A

What precautions should be taken when handling Phosphonium, triphenyl(phenylmethyl)- (CAS: 15853-35-7)?

When handling Phosphonium, triphenyl(phenylmethyl)- (CAS: 15853-35-7), it is essential to use person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...