Compound Q&A

What are the physical and chemical properties of Phosphonium, triphenyl(phenylmethyl)- (CAS: 15853-35-7)?

Answer

Phosphonium, triphenyl(phenylmethyl)-
Phosphonium, triphenyl(phenylmethyl)- (CAS: 15853-35-7) is a solid with a crystalline form. Its molecular weight is approximately 574.52 g/mol. The compound has low solubility in water but is soluble in organic solvents such as chloroform. Chemically, it is highly reactive, particularly towards nucleophiles and can form stable complexes with various metal ions. It is commonly used in organophosphorus chemistry and catalysis.

About

CAS No 15853-35-7
English Name Phosphonium, triphenyl(phenylmethyl)-
Molecular Formula C25H22P+
Molecular Weight 353.4 g/mol
SMILES C1=CC=C(C=C1)C[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4
InChIKey BNQRPLGZFADFGA-UHFFFAOYSA-N
Last Updated: 2026-03-23 00:14

Related Q&A

Compound Q&A

How is Phosphonium, triphenyl(phenylmethyl)- (CAS: 15853-35-7) typically synthesized?

Phosphonium, triphenyl(phenylmethyl)- (CAS: 15853-35-7) can be synthesized via the reaction of triph...

Compound Q&A

What industries use Phosphonium, triphenyl(phenylmethyl)- (CAS: 15853-35-7)?

Phosphonium, triphenyl(phenylmethyl)- (CAS: 15853-35-7) is primarily used in the pharmaceutical, pol...

Compound Q&A

What precautions should be taken when handling Phosphonium, triphenyl(phenylmethyl)- (CAS: 15853-35-7)?

When handling Phosphonium, triphenyl(phenylmethyl)- (CAS: 15853-35-7), it is essential to use person...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...