Compound Q&A

What industries use (2S)-1-(Diphenylphosphino)-3-phenyl-2-propanamine (CAS: 146476-38-2)?

Answer

(2S)-1-(Diphenylphosphino)-3-phenyl-2-propanamine
The compound (2S)-1-(Diphenylphosphino)-3-phenyl-2-propanamine (CAS: 146476-38-2) is primarily used in the pharmaceutical and chemical industries. It serves as a key ligand in transition metal catalysis, particularly in the development of chiral catalysts for the synthesis of pharmaceuticals and agrochemicals. The compound is also utilized in the production of polymers and as a ligand in organophosphorus chemistry.

About

English Name (2S)-1-(Diphenylphosphino)-3-phenyl-2-propanamine
Molecular Formula C21H22NP
Molecular Weight 319.39 g/mol
SMILES c1ccc(cc1)C[C@@H](CP(c2ccccc2)c3ccccc3)N
InChIKey SIOSCJGIYDRXMO-IBGZPJMESA-N
Last Updated: 2026-03-22 19:38

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S)-1-(Diphenylphosphino)-3-phenyl-2-propanamine (CAS: 146476-38-2)?

The compound (2S)-1-(Diphenylphosphino)-3-phenyl-2-propanamine (CAS: 146476-38-2) is a clear to slig...

Compound Q&A

How is (2S)-1-(Diphenylphosphino)-3-phenyl-2-propanamine (CAS: 146476-38-2) typically synthesized?

The compound (2S)-1-(Diphenylphosphino)-3-phenyl-2-propanamine (CAS: 146476-38-2) is typically synth...

Compound Q&A

What precautions should be taken when handling (2S)-1-(Diphenylphosphino)-3-phenyl-2-propanamine (CAS: 146476-38-2)?

When handling (2S)-1-(Diphenylphosphino)-3-phenyl-2-propanamine (CAS: 146476-38-2), it is important ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...