Compound Q&A

What industries use Thieno[2,3-f][1]benzothiene-2,6-diylbis(trimethylstannane) (CAS: 1242077-07-1)?

Answer

Thieno[2,3-f][1]benzothiene-2,6-diylbis(trimethylstannane)
Thieno[2,3-f][1]benzothiene-2,6-diylbis(trimethylstannane) is utilized in the pharmaceutical industry for its potential as a building block in drug synthesis. It also finds applications in the polymer industry for the development of new materials. Additionally, it can be used in the semiconductor and sensor industries due to its electronic properties.

About

English Name Thieno[2,3-f][1]benzothiene-2,6-diylbis(trimethylstannane)
Molecular Formula C16H22S2Sn2
Molecular Weight 515.91 g/mol
SMILES C[Sn](C)(C)c1cc2cc3c(cc2s1)cc(s3)[Sn](C)(C)C
InChIKey NSJUTGAFHWENGR-UHFFFAOYSA-N
Last Updated: 2026-03-22 14:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of Thieno[2,3-f][1]benzothiene-2,6-diylbis(trimethylstannane) (CAS: 1242077-07-1)?

Thieno[2,3-f][1]benzothiene-2,6-diylbis(trimethylstannane) is a solid with a crystalline form. It ha...

Compound Q&A

How is Thieno[2,3-f][1]benzothiene-2,6-diylbis(trimethylstannane) (CAS: 1242077-07-1) typically synthesized?

Thieno[2,3-f][1]benzothiene-2,6-diylbis(trimethylstannane) is typically synthesized through the reac...

Compound Q&A

What precautions should be taken when handling Thieno[2,3-f][1]benzothiene-2,6-diylbis(trimethylstannane) (CAS: 1242077-07-1)?

When handling Thieno[2,3-f][1]benzothiene-2,6-diylbis(trimethylstannane), it is important to use app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...