Compound Q&A

What are the physical and chemical properties of Thieno[2,3-f][1]benzothiene-2,6-diylbis(trimethylstannane) (CAS: 1242077-07-1)?

Answer

Thieno[2,3-f][1]benzothiene-2,6-diylbis(trimethylstannane)
Thieno[2,3-f][1]benzothiene-2,6-diylbis(trimethylstannane) is a solid with a crystalline form. It has a molecular weight of approximately 608.47 g/mol. This compound is sparingly soluble in common organic solvents. It is relatively stable but can react with acidic or basic conditions. It shows low reactivity under normal conditions but may undergo substitution reactions under certain conditions.

About

English Name Thieno[2,3-f][1]benzothiene-2,6-diylbis(trimethylstannane)
Molecular Formula C16H22S2Sn2
Molecular Weight 515.91 g/mol
SMILES C[Sn](C)(C)c1cc2cc3c(cc2s1)cc(s3)[Sn](C)(C)C
InChIKey NSJUTGAFHWENGR-UHFFFAOYSA-N
Last Updated: 2026-03-22 14:59

Related Q&A

Compound Q&A

How is Thieno[2,3-f][1]benzothiene-2,6-diylbis(trimethylstannane) (CAS: 1242077-07-1) typically synthesized?

Thieno[2,3-f][1]benzothiene-2,6-diylbis(trimethylstannane) is typically synthesized through the reac...

Compound Q&A

What industries use Thieno[2,3-f][1]benzothiene-2,6-diylbis(trimethylstannane) (CAS: 1242077-07-1)?

Thieno[2,3-f][1]benzothiene-2,6-diylbis(trimethylstannane) is utilized in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling Thieno[2,3-f][1]benzothiene-2,6-diylbis(trimethylstannane) (CAS: 1242077-07-1)?

When handling Thieno[2,3-f][1]benzothiene-2,6-diylbis(trimethylstannane), it is important to use app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...