Compound Q&A

How is Thieno[2,3-f][1]benzothiene-2,6-diylbis(trimethylstannane) (CAS: 1242077-07-1) typically synthesized?

Answer

Thieno[2,3-f][1]benzothiene-2,6-diylbis(trimethylstannane)
Thieno[2,3-f][1]benzothiene-2,6-diylbis(trimethylstannane) is typically synthesized through the reaction of thieno[2,3-f][1]benzothiophene with bis(trimethylstannyl)methane or similar stannylating reagents. The synthesis involves controlled conditions to achieve high selectivity and yield, often using palladium or nickel catalysis. The exact method can vary depending on the desired purity and reactivity of the final product.

About

English Name Thieno[2,3-f][1]benzothiene-2,6-diylbis(trimethylstannane)
Molecular Formula C16H22S2Sn2
Molecular Weight 515.91 g/mol
SMILES C[Sn](C)(C)c1cc2cc3c(cc2s1)cc(s3)[Sn](C)(C)C
InChIKey NSJUTGAFHWENGR-UHFFFAOYSA-N
Last Updated: 2026-03-22 14:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of Thieno[2,3-f][1]benzothiene-2,6-diylbis(trimethylstannane) (CAS: 1242077-07-1)?

Thieno[2,3-f][1]benzothiene-2,6-diylbis(trimethylstannane) is a solid with a crystalline form. It ha...

Compound Q&A

What industries use Thieno[2,3-f][1]benzothiene-2,6-diylbis(trimethylstannane) (CAS: 1242077-07-1)?

Thieno[2,3-f][1]benzothiene-2,6-diylbis(trimethylstannane) is utilized in the pharmaceutical industr...

Compound Q&A

What precautions should be taken when handling Thieno[2,3-f][1]benzothiene-2,6-diylbis(trimethylstannane) (CAS: 1242077-07-1)?

When handling Thieno[2,3-f][1]benzothiene-2,6-diylbis(trimethylstannane), it is important to use app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...