Compound Q&A

What are the physical and chemical properties of 4-Chloro-6-(4-methylphenyl)-2-(methylsulfanyl)-5-pyrimidinecarbonitrile (CAS: 128640-74-4)?

Answer

4-Chloro-6-(4-methylphenyl)-2-(methylsulfanyl)-5-pyrimidinecarbonitrile
4-Chloro-6-(4-methylphenyl)-2-(methylsulfanyl)-5-pyrimidinecarbonitrile is a crystalline solid with a molecular weight of approximately 334.68 g/mol. It is slightly soluble in water but more soluble in organic solvents like dichloromethane and acetone. This compound is known for its high reactivity, particularly towards nucleophiles and reducing agents. It is stable under normal conditions but should be stored in a cool, dry place away from direct sunlight.

About

English Name 4-Chloro-6-(4-methylphenyl)-2-(methylsulfanyl)-5-pyrimidinecarbonitrile
Molecular Formula C13H10ClN3S
Molecular Weight 264.781 g/mol
SMILES CC1=CC=C(C=C1)C2=C(C(=NC(=N2)SC)Cl)C#N
InChIKey ASPBFSRVAPVCDU-UHFFFAOYSA-N
Last Updated: 2026-03-22 14:59

Related Q&A

Compound Q&A

How is 4-Chloro-6-(4-methylphenyl)-2-(methylsulfanyl)-5-pyrimidinecarbonitrile (CAS: 128640-74-4) typically synthesized?

4-Chloro-6-(4-methylphenyl)-2-(methylsulfanyl)-5-pyrimidinecarbonitrile is typically synthesized thr...

Compound Q&A

What industries use 4-Chloro-6-(4-methylphenyl)-2-(methylsulfanyl)-5-pyrimidinecarbonitrile (CAS: 128640-74-4)?

4-Chloro-6-(4-methylphenyl)-2-(methylsulfanyl)-5-pyrimidinecarbonitrile is used in various industrie...

Compound Q&A

What precautions should be taken when handling 4-Chloro-6-(4-methylphenyl)-2-(methylsulfanyl)-5-pyrimidinecarbonitrile (CAS: 128640-74-4)?

When handling 4-Chloro-6-(4-methylphenyl)-2-(methylsulfanyl)-5-pyrimidinecarbonitrile, it is essenti...

Compound Q&A

What are the physical and chemical properties of Disodium 2-hydroxypentanedioate (CAS: 40951-21-1)?

Disodium 2-hydroxypentanedioate is a white crystalline solid with a molecular we...

40951-21-1Disodium 2-hydroxype...
Compound Q&A

What industries use 5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7)?

5-(Chlorosulfonyl)-2-methylbenzoyl chloride (CAS: 1426437-45-7) is primarily use...

1426437-45-75-(Chlorosulfonyl)-2...
Compound Q&A

How should (2R)-2-[(Tert-butoxy)carbonylamino]-2-(2-naphthyl)acetic acid (CAS: 93779-36-3) be stored?

(2R)-2-[(Tert-butoxy)carbonylamino]-2-(2-naphthyl)acetic acid (CAS: 93779-36-3) ...

93779-36-3(2R)-2-[(Tert-butoxy...
Compound Q&A

What industries use Methyl 6-bromo-2-pyridinecarboxylate (CAS: 26218-75-7)?

Methyl 6-bromo-2-pyridinecarboxylate (CAS: 26218-75-7) is primarily used in the ...

26218-75-7Methyl 6-bromo-2-pyr...