Compound Q&A

What precautions should be taken when handling 3-Chloro-6-(trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 760147-01-1)?

Answer

3-Chloro-6-(trifluoromethyl)-2-pyridinecarboxylic acid
When handling 3-Chloro-6-(trifluoromethyl)-2-pyridinecarboxylic acid, use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work in a well-ventilated area or a fume hood to minimize inhalation exposure. Spills should be cleaned up using appropriate absorbent materials and disposed of according to local regulations. Keep the compound away from heat and oxidizing agents. Refer to the safety data sheet (SDS) for detailed safety information.

About

English Name 3-Chloro-6-(trifluoromethyl)-2-pyridinecarboxylic acid
Molecular Formula C7H3ClF3NO2
Molecular Weight 225.55 g/mol
SMILES C1=CC(=NC(=C1Cl)C(=O)O)C(F)(F)F
InChIKey XXLAXZNHHWJHOO-UHFFFAOYSA-N
Last Updated: 2026-03-22 14:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Chloro-6-(trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 760147-01-1)?

3-Chloro-6-(trifluoromethyl)-2-pyridinecarboxylic acid is a crystalline solid with a molecular weigh...

Compound Q&A

How is 3-Chloro-6-(trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 760147-01-1) typically synthesized?

3-Chloro-6-(trifluoromethyl)-2-pyridinecarboxylic acid is typically synthesized via chlorination of ...

Compound Q&A

What industries use 3-Chloro-6-(trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 760147-01-1)?

3-Chloro-6-(trifluoromethyl)-2-pyridinecarboxylic acid is used in the pharmaceutical industry for th...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...