Compound Q&A

How is 3-Chloro-6-(trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 760147-01-1) typically synthesized?

Answer

3-Chloro-6-(trifluoromethyl)-2-pyridinecarboxylic acid
3-Chloro-6-(trifluoromethyl)-2-pyridinecarboxylic acid is typically synthesized via chlorination of 6-(trifluoromethyl)-2-pyridinecarboxylic acid or through direct substitution of chlorine on the pyridine ring. The reaction can be catalyzed by Lewis acids such as aluminum chloride. The yield is generally high, and the product is isolated via crystallization from solvents.

About

English Name 3-Chloro-6-(trifluoromethyl)-2-pyridinecarboxylic acid
Molecular Formula C7H3ClF3NO2
Molecular Weight 225.55 g/mol
SMILES C1=CC(=NC(=C1Cl)C(=O)O)C(F)(F)F
InChIKey XXLAXZNHHWJHOO-UHFFFAOYSA-N
Last Updated: 2026-03-22 14:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Chloro-6-(trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 760147-01-1)?

3-Chloro-6-(trifluoromethyl)-2-pyridinecarboxylic acid is a crystalline solid with a molecular weigh...

Compound Q&A

What industries use 3-Chloro-6-(trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 760147-01-1)?

3-Chloro-6-(trifluoromethyl)-2-pyridinecarboxylic acid is used in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling 3-Chloro-6-(trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 760147-01-1)?

When handling 3-Chloro-6-(trifluoromethyl)-2-pyridinecarboxylic acid, use appropriate personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...