Compound Q&A

What industries use (3beta,5beta,7beta)-3,7,14-Trihydroxybufa-20,22-dienolide (CAS: 20143-97-9)?

Answer

(3beta,5beta,7beta)-3,7,14-Trihydroxybufa-20,22-dienolide
(3beta,5beta,7beta)-3,7,14-Trihydroxybufa-20,22-dienolide is primarily used in the pharmaceutical industry for its cardiac and antitumor properties. It is also of interest in the natural product chemistry and drug discovery sectors. Its applications in the production of semi-synthetic cardiac glycosides for therapeutic use are well-known, and it is also studied for potential uses in polymer synthesis and biosensor development.

About

CAS No 20143-97-9
English Name (3beta,5beta,7beta)-3,7,14-Trihydroxybufa-20,22-dienolide
Molecular Formula C24H34O5
Molecular Weight 402.52 g/mol
SMILES C[C@]12CC[C@H](O)C[C@H]1C[C@H](O)[C@@H]1[C@@H]2CC[C@]2(C)[C@H](CC[C@@]21O)C1C=CC(=O)OC=1
InChIKey IZQUQFWHNJERCJ-XKPFVIKISA-N
Last Updated: 2026-03-20 10:59

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3beta,5beta,7beta)-3,7,14-Trihydroxybufa-20,22-dienolide (CAS: 20143-97-9)?

(3beta,5beta,7beta)-3,7,14-Trihydroxybufa-20,22-dienolide is a white crystalline solid with a molecu...

Compound Q&A

How is (3beta,5beta,7beta)-3,7,14-Trihydroxybufa-20,22-dienolide (CAS: 20143-97-9) typically synthesized?

(3beta,5beta,7beta)-3,7,14-Trihydroxybufa-20,22-dienolide is typically synthesized through semi-synt...

Compound Q&A

What precautions should be taken when handling (3beta,5beta,7beta)-3,7,14-Trihydroxybufa-20,22-dienolide (CAS: 20143-97-9)?

When handling (3beta,5beta,7beta)-3,7,14-Trihydroxybufa-20,22-dienolide, it is essential to wear app...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...